C23H44F2N7O+ — CID 123565594
3,3-diamino-2-(4-fluoro-2-aza-6-azoniaspiro[5.5]undecan-1-yl)-N-[5-fluoro-4-(4-methylpiperidin-1-yl)piperidin-3-yl]propanamide (PubChem CID 123565594) has the molecular formula C23H44F2N7O+ and a molecular weight of 472.65 g/mol. Its IUPAC name is 3,3-diamino-2-(4-fluoro-2-aza-6-azoniaspiro[5.5]undecan-1-yl)-N-[5-fluoro-4-(4-methylpiperidin-1-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(4-fluoro-2-aza-6-azoniaspiro[5.5]undecan-1-yl)-N-[5-fluoro-4-(4-methylpiperidin-1-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123565594 |
| Molecular Formula | C23H44F2N7O+ |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | 3,3-diamino-2-(4-fluoro-2-aza-6-azoniaspiro[5.5]undecan-1-yl)-N-[5-fluoro-4-(4-methylpiperidin-1-yl)piperidin-3-yl]propanamide |
| SMILES | CC1CCN(C2C(F)CNCC2NC(=O)C(C(N)N)C2NCC(F)C[N+]23CCCCC3)CC1 |
| InChI | InChI=1S/C23H43F2N7O/c1-15-5-7-31(8-6-15)20-17(25)12-28-13-18(20)30-23(33)19(21(26)27)22-29-11-16(24)14-32(22)9-3-2-4-10-32/h15-22,28-29H,2-14,26-27H2,1H3/p+1 |
| InChIKey | GAQFGUNQOLVYAP-UHFFFAOYSA-O |
| XLogP | -0.36 |
| TPSA | 108.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|