C19H22N2O4 — CID 123566254
(1S,2S,4R,11S)-4-methyl-12-methylidene-8-(2-methylimidazole-1-carbonyl)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 123566254) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (1S,2S,4R,11S)-4-methyl-12-methylidene-8-(2-methylimidazole-1-carbonyl)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (1S,2S,4R,11S)-4-methyl-12-methylidene-8-(2-methylimidazole-1-carbonyl)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 123566254 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (1S,2S,4R,11S)-4-methyl-12-methylidene-8-(2-methylimidazole-1-carbonyl)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CCC(C(=O)n1ccnc1C)=CCC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C19H22N2O4/c1-11-14-7-6-13(17(22)21-10-9-20-12(21)2)5-4-8-19(3)16(25-19)15(14)24-18(11)23/h5,9-10,14-16H,1,4,6-8H2,2-3H3/t14-,15-,16-,19+/m0/s1 |
| InChIKey | YPYLGIXPPYMKFI-IUVQAAGXSA-N |
| XLogP | 2.59 |
| TPSA | 73.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|