C20H28N2O4 — CID 123918647
(1S,2S,4R,11S)-4-methyl-12-methylidene-8-(4-methylpiperazine-1-carbonyl)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 123918647) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is (1S,2S,4R,11S)-4-methyl-12-methylidene-8-(4-methylpiperazine-1-carbonyl)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (1S,2S,4R,11S)-4-methyl-12-methylidene-8-(4-methylpiperazine-1-carbonyl)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 123918647 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (1S,2S,4R,11S)-4-methyl-12-methylidene-8-(4-methylpiperazine-1-carbonyl)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CCC(C(=O)N1CCN(C)CC1)=CCC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C20H28N2O4/c1-13-15-7-6-14(18(23)22-11-9-21(3)10-12-22)5-4-8-20(2)17(26-20)16(15)25-19(13)24/h5,15-17H,1,4,6-12H2,2-3H3/t15-,16-,17-,20+/m0/s1 |
| InChIKey | ROFUFJKHDPEXLC-OGNFBWPZSA-N |
| XLogP | 1.52 |
| TPSA | 62.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|