C26H32O7 — CID 155567271
[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 3-(2,6-dimethoxyphenyl)propanoate (PubChem CID 155567271) has the molecular formula C26H32O7 and a molecular weight of 456.54 g/mol. Its IUPAC name is [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 3-(2,6-dimethoxyphenyl)propanoate.
| Compound Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 3-(2,6-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 155567271 |
| Molecular Formula | C26H32O7 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 3-(2,6-dimethoxyphenyl)propanoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)CCc1c(OC)cccc1OC)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C26H32O7/c1-16-18-11-10-17(7-6-14-26(2)24(33-26)23(18)32-25(16)28)15-31-22(27)13-12-19-20(29-3)8-5-9-21(19)30-4/h5,7-9,18,23-24H,1,6,10-15H2,2-4H3/b17-7+/t18-,23-,24-,26+/m0/s1 |
| InChIKey | UWMLOIVCUCYTQA-MJXAAHRASA-N |
| XLogP | 3.94 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|