C26H25BrO6 — CID 127050388
[(1S,2S,4R,7Z,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 5-(4-bromophenyl)furan-3-carboxylate (PubChem CID 127050388) has the molecular formula C26H25BrO6 and a molecular weight of 513.38 g/mol. Its IUPAC name is [(1S,2S,4R,7Z,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 5-(4-bromophenyl)furan-3-carboxylate.
| Compound Name | [(1S,2S,4R,7Z,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 5-(4-bromophenyl)furan-3-carboxylate |
|---|---|
| PubChem CID | 127050388 |
| Molecular Formula | C26H25BrO6 |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | [(1S,2S,4R,7Z,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 5-(4-bromophenyl)furan-3-carboxylate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)c1coc(-c3ccc(Br)cc3)c1)=C/CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C26H25BrO6/c1-15-20-10-5-16(4-3-11-26(2)23(33-26)22(20)32-24(15)28)13-31-25(29)18-12-21(30-14-18)17-6-8-19(27)9-7-17/h4,6-9,12,14,20,22-23H,1,3,5,10-11,13H2,2H3/b16-4-/t20-,22-,23-,26+/m0/s1 |
| InChIKey | ORAHLGXRHCHPEQ-LLWNRSMGSA-N |
| XLogP | 5.62 |
| TPSA | 78.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|