C20H29NO6 — CID 123623273
2-(dimethylamino)ethyl [(1S,2S,4R,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl carbonate (PubChem CID 123623273) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl [(1S,2S,4R,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl carbonate.
| Compound Name | 2-(dimethylamino)ethyl [(1S,2S,4R,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl carbonate |
|---|---|
| PubChem CID | 123623273 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2-(dimethylamino)ethyl [(1S,2S,4R,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl carbonate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CCC(COC(=O)OCCN(C)C)=CCC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C20H29NO6/c1-13-15-8-7-14(12-25-19(23)24-11-10-21(3)4)6-5-9-20(2)17(27-20)16(15)26-18(13)22/h6,15-17H,1,5,7-12H2,2-4H3/t15-,16-,17-,20+/m0/s1 |
| InChIKey | IITNCUNPMKJUKC-OGNFBWPZSA-N |
| XLogP | 2.46 |
| TPSA | 77.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|