C26H27NO5 — CID 155805748
[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl (E)-3-(1H-indol-3-yl)prop-2-enoate (PubChem CID 155805748) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl (E)-3-(1H-indol-3-yl)prop-2-enoate.
| Compound Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl (E)-3-(1H-indol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 155805748 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl (E)-3-(1H-indol-3-yl)prop-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)/C=C/c1c[nH]c3ccccc13)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C26H27NO5/c1-16-19-11-9-17(6-5-13-26(2)24(32-26)23(19)31-25(16)29)15-30-22(28)12-10-18-14-27-21-8-4-3-7-20(18)21/h3-4,6-8,10,12,14,19,23-24,27H,1,5,9,11,13,15H2,2H3/b12-10+,17-6+/t19-,23-,24-,26+/m0/s1 |
| InChIKey | SWCKSLZJWHNNPE-INJOPXNBSA-N |
| XLogP | 4.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|