C27H32N2O6 — CID 155813269
[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamate (PubChem CID 155813269) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamate.
| Compound Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 155813269 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-[2-(5-methoxy-1H-indol-3-yl)ethyl]carbamate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)NCCc1c[nH]c3ccc(OC)cc13)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C27H32N2O6/c1-16-20-8-6-17(5-4-11-27(2)24(35-27)23(20)34-25(16)30)15-33-26(31)28-12-10-18-14-29-22-9-7-19(32-3)13-21(18)22/h5,7,9,13-14,20,23-24,29H,1,4,6,8,10-12,15H2,2-3H3,(H,28,31)/b17-5+/t20-,23-,24-,27+/m0/s1 |
| InChIKey | QBJFIYKXBCTYOL-AOJANBIMSA-N |
| XLogP | 4.20 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|