C28H34O7 — CID 155515655
[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl (2E)-2-[(2,5-dimethoxyphenyl)methylidene]butanoate (PubChem CID 155515655) has the molecular formula C28H34O7 and a molecular weight of 482.57 g/mol. Its IUPAC name is [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl (2E)-2-[(2,5-dimethoxyphenyl)methylidene]butanoate.
| Compound Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl (2E)-2-[(2,5-dimethoxyphenyl)methylidene]butanoate |
|---|---|
| PubChem CID | 155515655 |
| Molecular Formula | C28H34O7 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl (2E)-2-[(2,5-dimethoxyphenyl)methylidene]butanoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)/C(=C/c1cc(OC)ccc1OC)CC)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C28H34O7/c1-6-19(14-20-15-21(31-4)10-12-23(20)32-5)27(30)33-16-18-8-7-13-28(3)25(35-28)24-22(11-9-18)17(2)26(29)34-24/h8,10,12,14-15,22,24-25H,2,6-7,9,11,13,16H2,1,3-5H3/b18-8+,19-14+/t22-,24-,25-,28+/m0/s1 |
| InChIKey | QJVMQWOIDUFOOW-FAQYBXBNSA-N |
| XLogP | 4.80 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|