C23H25F3O4 — CID 86567376
(1S,2R,4R,7E,11S)-4-methyl-12-methylidene-8-[[4-(trifluoromethyl)phenyl]methoxymethyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 86567376) has the molecular formula C23H25F3O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is (1S,2R,4R,7E,11S)-4-methyl-12-methylidene-8-[[4-(trifluoromethyl)phenyl]methoxymethyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (1S,2R,4R,7E,11S)-4-methyl-12-methylidene-8-[[4-(trifluoromethyl)phenyl]methoxymethyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 86567376 |
| Molecular Formula | C23H25F3O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (1S,2R,4R,7E,11S)-4-methyl-12-methylidene-8-[[4-(trifluoromethyl)phenyl]methoxymethyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]3O[C@]3(C)CC/C=C(/COCc3ccc(C(F)(F)F)cc3)CC[C@@H]12 |
| InChI | InChI=1S/C23H25F3O4/c1-14-18-10-7-15(4-3-11-22(2)20(30-22)19(18)29-21(14)27)12-28-13-16-5-8-17(9-6-16)23(24,25)26/h4-6,8-9,18-20H,1,3,7,10-13H2,2H3/b15-4+/t18-,19-,20+,22+/m0/s1 |
| InChIKey | RMKZOZWMCGVOGY-KVTTZEBHSA-N |
| XLogP | 4.98 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|