C26H30N2O5 — CID 155811000
[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-[2-(1H-indol-3-yl)ethyl]carbamate (PubChem CID 155811000) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-[2-(1H-indol-3-yl)ethyl]carbamate.
| Compound Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-[2-(1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 155811000 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-[2-(1H-indol-3-yl)ethyl]carbamate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)NCCc1c[nH]c3ccccc13)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C26H30N2O5/c1-16-19-10-9-17(6-5-12-26(2)23(33-26)22(19)32-24(16)29)15-31-25(30)27-13-11-18-14-28-21-8-4-3-7-20(18)21/h3-4,6-8,14,19,22-23,28H,1,5,9-13,15H2,2H3,(H,27,30)/b17-6+/t19-,22-,23-,26+/m0/s1 |
| InChIKey | VOSYYVVFRFJSNC-CFMNMBJRSA-N |
| XLogP | 4.19 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|