C28H37NO4 — CID 155810677
N-[[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl]-2-[4-(2-methylpropyl)phenyl]propanamide (PubChem CID 155810677) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is N-[[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl]-2-[4-(2-methylpropyl)phenyl]propanamide.
| Compound Name | N-[[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
|---|---|
| PubChem CID | 155810677 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | N-[[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl]-2-[4-(2-methylpropyl)phenyl]propanamide |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(CNC(=O)C(C)c1ccc(CC(C)C)cc1)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C28H37NO4/c1-17(2)15-20-8-11-22(12-9-20)18(3)26(30)29-16-21-7-6-14-28(5)25(33-28)24-23(13-10-21)19(4)27(31)32-24/h7-9,11-12,17-18,23-25H,4,6,10,13-16H2,1-3,5H3,(H,29,30)/b21-7+/t18?,23-,24-,25-,28+/m0/s1 |
| InChIKey | MHWDIEYCBPYGLO-WGXNNALFSA-N |
| XLogP | 4.86 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|