C25H27NO5S — CID 118245701
N-[[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl]naphthalene-2-sulfonamide (PubChem CID 118245701) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl]naphthalene-2-sulfonamide.
| Compound Name | N-[[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 118245701 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-[[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl]naphthalene-2-sulfonamide |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(CNS(=O)(=O)c1ccc3ccccc3c1)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C25H27NO5S/c1-16-21-12-9-17(6-5-13-25(2)23(31-25)22(21)30-24(16)27)15-26-32(28,29)20-11-10-18-7-3-4-8-19(18)14-20/h3-4,6-8,10-11,14,21-23,26H,1,5,9,12-13,15H2,2H3/b17-6+/t21-,22-,23-,25+/m0/s1 |
| InChIKey | IZHXIGLMSGTKPT-FPISHOKTSA-N |
| XLogP | 3.87 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|