C24H27N3O5 — CID 134129970
[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-(1H-benzimidazol-2-ylmethyl)carbamate (PubChem CID 134129970) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-(1H-benzimidazol-2-ylmethyl)carbamate.
| Compound Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-(1H-benzimidazol-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 134129970 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-(1H-benzimidazol-2-ylmethyl)carbamate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)NCc1nc3ccccc3[nH]1)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C24H27N3O5/c1-14-16-10-9-15(6-5-11-24(2)21(32-24)20(16)31-22(14)28)13-30-23(29)25-12-19-26-17-7-3-4-8-18(17)27-19/h3-4,6-8,16,20-21H,1,5,9-13H2,2H3,(H,25,29)(H,26,27)/b15-6+/t16-,20-,21-,24+/m0/s1 |
| InChIKey | DSQXVMGHHYCXFA-XUVHLHGVSA-N |
| XLogP | 3.54 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|