C10H11N3O3Y — CID 171659142
1H-benzimidazol-2-ylmethyl N-(hydroxymethyl)carbamate;yttrium (PubChem CID 171659142) has the molecular formula C10H11N3O3Y and a molecular weight of 310.12 g/mol. Its IUPAC name is 1H-benzimidazol-2-ylmethyl N-(hydroxymethyl)carbamate;yttrium.
| Compound Name | 1H-benzimidazol-2-ylmethyl N-(hydroxymethyl)carbamate;yttrium |
|---|---|
| PubChem CID | 171659142 |
| Molecular Formula | C10H11N3O3Y |
| Molecular Weight | 310.12 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 1H-benzimidazol-2-ylmethyl N-(hydroxymethyl)carbamate;yttrium |
| SMILES | O=C(NCO)OCc1nc2ccccc2[nH]1.[Y] |
| InChI | InChI=1S/C10H11N3O3.Y/c14-6-11-10(15)16-5-9-12-7-3-1-2-4-8(7)13-9;/h1-4,14H,5-6H2,(H,11,15)(H,12,13); |
| InChIKey | SFFRCJCMJNBWQR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.12 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|