C19H20N4O3 — CID 2065366
benzyl N-[2-[2-(1H-benzimidazol-2-yl)ethylamino]-2-oxoethyl]carbamate (PubChem CID 2065366) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is benzyl N-[2-[2-(1H-benzimidazol-2-yl)ethylamino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[2-(1H-benzimidazol-2-yl)ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 2065366 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | benzyl N-[2-[2-(1H-benzimidazol-2-yl)ethylamino]-2-oxoethyl]carbamate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H20N4O3/c24-18(12-21-19(25)26-13-14-6-2-1-3-7-14)20-11-10-17-22-15-8-4-5-9-16(15)23-17/h1-9H,10-13H2,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | MUXVIWWJVPPZDU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |