C22H28N4O2 — CID 20577728
benzyl N-[6-(1H-benzimidazol-2-ylmethylamino)hexyl]carbamate (PubChem CID 20577728) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is benzyl N-[6-(1H-benzimidazol-2-ylmethylamino)hexyl]carbamate.
| Compound Name | benzyl N-[6-(1H-benzimidazol-2-ylmethylamino)hexyl]carbamate |
|---|---|
| PubChem CID | 20577728 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | benzyl N-[6-(1H-benzimidazol-2-ylmethylamino)hexyl]carbamate |
| SMILES | O=C(NCCCCCCNCc1nc2ccccc2[nH]1)OCc1ccccc1 |
| InChI | InChI=1S/C22H28N4O2/c27-22(28-17-18-10-4-3-5-11-18)24-15-9-2-1-8-14-23-16-21-25-19-12-6-7-13-20(19)26-21/h3-7,10-13,23H,1-2,8-9,14-17H2,(H,24,27)(H,25,26) |
| InChIKey | MCXGBROTTZNLRD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|