C30H32N4O4 — CID 10720544
benzyl N-[2-[6-(acridine-9-carbonylamino)hexylamino]-2-oxoethyl]carbamate (PubChem CID 10720544) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is benzyl N-[2-[6-(acridine-9-carbonylamino)hexylamino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[6-(acridine-9-carbonylamino)hexylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 10720544 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | benzyl N-[2-[6-(acridine-9-carbonylamino)hexylamino]-2-oxoethyl]carbamate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NCCCCCCNC(=O)c1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C30H32N4O4/c35-27(20-33-30(37)38-21-22-12-4-3-5-13-22)31-18-10-1-2-11-19-32-29(36)28-23-14-6-8-16-25(23)34-26-17-9-7-15-24(26)28/h3-9,12-17H,1-2,10-11,18-21H2,(H,31,35)(H,32,36)(H,33,37) |
| InChIKey | RRCLGCVOVVEQQO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|