About 1H-benzimidazol-2-ylmethyl 2-sulfanylacetate
1H-benzimidazol-2-ylmethyl 2-sulfanylacetate (PubChem CID 168757870) has the molecular formula C10H10N2O2S
and a molecular weight of 222.27 g/mol. Its IUPAC name is 1H-benzimidazol-2-ylmethyl 2-sulfanylacetate.
Molecular Properties
| Compound Name | 1H-benzimidazol-2-ylmethyl 2-sulfanylacetate |
| PubChem CID | 168757870 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 1H-benzimidazol-2-ylmethyl 2-sulfanylacetate |
| SMILES | O=C(CS)OCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H10N2O2S/c13-10(6-15)14-5-9-11-7-3-1-2-4-8(7)12-9/h1-4,15H,5-6H2,(H,11,12) |
| InChIKey | WVPXJBUXJNWULL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazol-2-ylmethyl 2-sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazol-2-ylmethyl 2-sulfanylacetate?
The IUPAC name of 1H-benzimidazol-2-ylmethyl 2-sulfanylacetate (CID 168757870) is 1H-benzimidazol-2-ylmethyl 2-sulfanylacetate.
What is the SMILES notation for 1H-benzimidazol-2-ylmethyl 2-sulfanylacetate?
The canonical SMILES for 1H-benzimidazol-2-ylmethyl 2-sulfanylacetate is O=C(CS)OCc1nc2ccccc2[nH]1.
What is the InChIKey of 1H-benzimidazol-2-ylmethyl 2-sulfanylacetate?
The InChIKey is WVPXJBUXJNWULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S/c13-10(6-15)14-5-9-11-7-3-1-2-4-8(7)12-9/h1-4,15H,5-6H2,(H,11,12).
What are the key properties of 1H-benzimidazol-2-ylmethyl 2-sulfanylacetate?
1H-benzimidazol-2-ylmethyl 2-sulfanylacetate has a molecular weight of 222.27 g/mol, XLogP of 1.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazol-2-ylmethyl 2-sulfanylacetate is sourced from PubChem (CID 168757870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).