C16H14N2O3 — CID 54117678
1H-benzimidazol-2-ylmethyl (2R)-2-hydroxy-2-phenylacetate (PubChem CID 54117678) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1H-benzimidazol-2-ylmethyl (2R)-2-hydroxy-2-phenylacetate.
| Compound Name | 1H-benzimidazol-2-ylmethyl (2R)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 54117678 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1H-benzimidazol-2-ylmethyl (2R)-2-hydroxy-2-phenylacetate |
| SMILES | O=C(OCc1nc2ccccc2[nH]1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O3/c19-15(11-6-2-1-3-7-11)16(20)21-10-14-17-12-8-4-5-9-13(12)18-14/h1-9,15,19H,10H2,(H,17,18)/t15-/m1/s1 |
| InChIKey | NLMGPIIMQJZXBL-OAHLLOKOSA-N |
| XLogP | 2.34 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |