C25H31NO6 — CID 155807928
[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-[2-(2-methoxyphenyl)ethyl]carbamate (PubChem CID 155807928) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-[2-(2-methoxyphenyl)ethyl]carbamate.
| Compound Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-[2-(2-methoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 155807928 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl N-[2-(2-methoxyphenyl)ethyl]carbamate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)NCCc1ccccc1OC)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C25H31NO6/c1-16-19-11-10-17(7-6-13-25(2)22(32-25)21(19)31-23(16)27)15-30-24(28)26-14-12-18-8-4-5-9-20(18)29-3/h4-5,7-9,19,21-22H,1,6,10-15H2,2-3H3,(H,26,28)/b17-7+/t19-,21-,22-,25+/m0/s1 |
| InChIKey | LXULJZFYPWXHDS-CNCBAHQJSA-N |
| XLogP | 3.72 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|