C24H24ClNO5 — CID 155810362
[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 5-chloro-1H-indole-2-carboxylate (PubChem CID 155810362) has the molecular formula C24H24ClNO5 and a molecular weight of 441.91 g/mol. Its IUPAC name is [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 5-chloro-1H-indole-2-carboxylate.
| Compound Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 5-chloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 155810362 |
| Molecular Formula | C24H24ClNO5 |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 5-chloro-1H-indole-2-carboxylate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)c1cc3cc(Cl)ccc3[nH]1)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C24H24ClNO5/c1-13-17-7-5-14(4-3-9-24(2)21(31-24)20(17)30-22(13)27)12-29-23(28)19-11-15-10-16(25)6-8-18(15)26-19/h4,6,8,10-11,17,20-21,26H,1,3,5,7,9,12H2,2H3/b14-4+/t17-,20-,21-,24+/m0/s1 |
| InChIKey | JKROFEPRZWSJPJ-QGEJRNGNSA-N |
| XLogP | 4.73 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|