C19H22O4S — CID 118714045
(1S,2S,4R,7E,11R,12E)-8-(hydroxymethyl)-4-methyl-12-(thiophen-3-ylmethylidene)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 118714045) has the molecular formula C19H22O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is (1S,2S,4R,7E,11R,12E)-8-(hydroxymethyl)-4-methyl-12-(thiophen-3-ylmethylidene)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (1S,2S,4R,7E,11R,12E)-8-(hydroxymethyl)-4-methyl-12-(thiophen-3-ylmethylidene)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 118714045 |
| Molecular Formula | C19H22O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (1S,2S,4R,7E,11R,12E)-8-(hydroxymethyl)-4-methyl-12-(thiophen-3-ylmethylidene)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | C[C@@]12CC/C=C(/CO)CC[C@@H]3/C(=C\c4ccsc4)C(=O)O[C@@H]3[C@@H]1O2 |
| InChI | InChI=1S/C19H22O4S/c1-19-7-2-3-12(10-20)4-5-14-15(9-13-6-8-24-11-13)18(21)22-16(14)17(19)23-19/h3,6,8-9,11,14,16-17,20H,2,4-5,7,10H2,1H3/b12-3+,15-9+/t14-,16+,17+,19-/m1/s1 |
| InChIKey | MKARJYPMOSGBAR-HNLQGRKUSA-N |
| XLogP | 3.32 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|