C28H37NO4 — CID 123566695
N,N-diethyl-2-[5-hydroxy-3,3-bis(phenylmethoxymethyl)cyclohexylidene]acetamide (PubChem CID 123566695) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is N,N-diethyl-2-[5-hydroxy-3,3-bis(phenylmethoxymethyl)cyclohexylidene]acetamide.
| Compound Name | N,N-diethyl-2-[5-hydroxy-3,3-bis(phenylmethoxymethyl)cyclohexylidene]acetamide |
|---|---|
| PubChem CID | 123566695 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | N,N-diethyl-2-[5-hydroxy-3,3-bis(phenylmethoxymethyl)cyclohexylidene]acetamide |
| SMILES | CCN(CC)C(=O)C=C1CC(O)CC(COCc2ccccc2)(COCc2ccccc2)C1 |
| InChI | InChI=1S/C28H37NO4/c1-3-29(4-2)27(31)16-25-15-26(30)18-28(17-25,21-32-19-23-11-7-5-8-12-23)22-33-20-24-13-9-6-10-14-24/h5-14,16,26,30H,3-4,15,17-22H2,1-2H3 |
| InChIKey | HKJKECOFKUALAY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|