C28H31NO4 — CID 11015750
(E,5R)-5-hydroxy-N-methoxy-N-methyl-7-trityloxyhept-2-enamide (PubChem CID 11015750) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is (E,5R)-5-hydroxy-N-methoxy-N-methyl-7-trityloxyhept-2-enamide.
| Compound Name | (E,5R)-5-hydroxy-N-methoxy-N-methyl-7-trityloxyhept-2-enamide |
|---|---|
| PubChem CID | 11015750 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (E,5R)-5-hydroxy-N-methoxy-N-methyl-7-trityloxyhept-2-enamide |
| SMILES | CON(C)C(=O)/C=C/C[C@@H](O)CCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31NO4/c1-29(32-2)27(31)20-12-19-26(30)21-22-33-28(23-13-6-3-7-14-23,24-15-8-4-9-16-24)25-17-10-5-11-18-25/h3-18,20,26,30H,19,21-22H2,1-2H3/b20-12+/t26-/m1/s1 |
| InChIKey | DSKWZBVLCDKFOX-ACDJESIYSA-N |
| XLogP | 4.71 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|