C5H10N2 — CID 123566768
N,N-dimethyl-2-(methylideneamino)ethenamine (PubChem CID 123566768) has the molecular formula C5H10N2 and a molecular weight of 98.15 g/mol. Its IUPAC name is N,N-dimethyl-2-(methylideneamino)ethenamine.
| Compound Name | N,N-dimethyl-2-(methylideneamino)ethenamine |
|---|---|
| PubChem CID | 123566768 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | N,N-dimethyl-2-(methylideneamino)ethenamine |
| SMILES | C=NC=CN(C)C |
| InChI | InChI=1S/C5H10N2/c1-6-4-5-7(2)3/h4-5H,1H2,2-3H3 |
| InChIKey | SWHCENCJSPTVKS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|