C16H21Cl2N2O+ — CID 123566788
2-(4-chlorohexa-2,4-dien-2-ylcarbamoyl)prop-2-enylidene-(3-chloropenta-1,3-dien-2-yl)-methylazanium (PubChem CID 123566788) has the molecular formula C16H21Cl2N2O+ and a molecular weight of 328.26 g/mol. Its IUPAC name is 2-(4-chlorohexa-2,4-dien-2-ylcarbamoyl)prop-2-enylidene-(3-chloropenta-1,3-dien-2-yl)-methylazanium.
| Compound Name | 2-(4-chlorohexa-2,4-dien-2-ylcarbamoyl)prop-2-enylidene-(3-chloropenta-1,3-dien-2-yl)-methylazanium |
|---|---|
| PubChem CID | 123566788 |
| Molecular Formula | C16H21Cl2N2O+ |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-(4-chlorohexa-2,4-dien-2-ylcarbamoyl)prop-2-enylidene-(3-chloropenta-1,3-dien-2-yl)-methylazanium |
| SMILES | C=C(/C=[N+](\C)C(=C)C(Cl)=CC)C(=O)NC(C)=CC(Cl)=CC |
| InChI | InChI=1S/C16H20Cl2N2O/c1-7-14(17)9-12(4)19-16(21)11(3)10-20(6)13(5)15(18)8-2/h7-10H,3,5H2,1-2,4,6H3/p+1/b12-9?,14-7?,15-8?,20-10+ |
| InChIKey | UBWDPNSHPKQIOL-JYNFETLISA-O |
| XLogP | 4.07 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|