C11H15ClN2O — CID 123446502
N-(4-chlorohexa-2,4-dien-2-yl)-2-(methyliminomethyl)prop-2-enamide (PubChem CID 123446502) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is N-(4-chlorohexa-2,4-dien-2-yl)-2-(methyliminomethyl)prop-2-enamide.
| Compound Name | N-(4-chlorohexa-2,4-dien-2-yl)-2-(methyliminomethyl)prop-2-enamide |
|---|---|
| PubChem CID | 123446502 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-(4-chlorohexa-2,4-dien-2-yl)-2-(methyliminomethyl)prop-2-enamide |
| SMILES | C=C(/C=N/C)C(=O)NC(C)=CC(Cl)=CC |
| InChI | InChI=1S/C11H15ClN2O/c1-5-10(12)6-9(3)14-11(15)8(2)7-13-4/h5-7H,2H2,1,3-4H3,(H,14,15)/b9-6?,10-5?,13-7+ |
| InChIKey | OTTFZHMVPZLAOV-IYEUIZPGSA-N |
| XLogP | 2.41 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|