C13H19ClN2O — CID 123557280
N-(4-chloropenta-1,3-dien-2-yl)-2-(methyliminomethyl)hex-2-enamide (PubChem CID 123557280) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is N-(4-chloropenta-1,3-dien-2-yl)-2-(methyliminomethyl)hex-2-enamide.
| Compound Name | N-(4-chloropenta-1,3-dien-2-yl)-2-(methyliminomethyl)hex-2-enamide |
|---|---|
| PubChem CID | 123557280 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-(4-chloropenta-1,3-dien-2-yl)-2-(methyliminomethyl)hex-2-enamide |
| SMILES | C=C(C=C(C)Cl)NC(=O)C(=CCCC)/C=N/C |
| InChI | InChI=1S/C13H19ClN2O/c1-5-6-7-12(9-15-4)13(17)16-11(3)8-10(2)14/h7-9H,3,5-6H2,1-2,4H3,(H,16,17)/b10-8?,12-7?,15-9+ |
| InChIKey | ZXLMGUHTGYZCCU-OQFQPNLOSA-N |
| XLogP | 3.19 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|