C30H47N3O — CID 142583890
butane;(E)-N-[(2E,4Z)-6-(2,3-dimethyl-2,3-dihydropyridin-5-yl)-4-[(Z)-1-ethenylprop-1-enyl]hepta-2,4,6-trien-2-yl]-2-methanimidoylbut-2-enamide;ethane (PubChem CID 142583890) has the molecular formula C30H47N3O and a molecular weight of 465.73 g/mol. Its IUPAC name is butane;(E)-N-[(2E,4Z)-6-(2,3-dimethyl-2,3-dihydropyridin-5-yl)-4-[(Z)-1-ethenylprop-1-enyl]hepta-2,4,6-trien-2-yl]-2-methanimidoylbut-2-enamide;ethane.
| Compound Name | butane;(E)-N-[(2E,4Z)-6-(2,3-dimethyl-2,3-dihydropyridin-5-yl)-4-[(Z)-1-ethenylprop-1-enyl]hepta-2,4,6-trien-2-yl]-2-methanimidoylbut-2-enamide;ethane |
|---|---|
| PubChem CID | 142583890 |
| Molecular Formula | C30H47N3O |
| Molecular Weight | 465.73 g/mol |
| Exact Mass | 465.37 |
| IUPAC Name | butane;(E)-N-[(2E,4Z)-6-(2,3-dimethyl-2,3-dihydropyridin-5-yl)-4-[(Z)-1-ethenylprop-1-enyl]hepta-2,4,6-trien-2-yl]-2-methanimidoylbut-2-enamide;ethane |
| SMILES | CC.CCCC.[H]/N=C/C(=C\C)C(=O)N/C(C)=C/C(=C/C(=C)C1=CC(C)C(C)N=C1)/C(C=C)=C\C |
| InChI | InChI=1S/C24H31N3O.C4H10.C2H6/c1-8-20(9-2)22(13-18(6)27-24(28)21(10-3)14-25)12-17(5)23-11-16(4)19(7)26-15-23;1-3-4-2;1-2/h8-16,19,25H,1,5H2,2-4,6-7H3,(H,27,28);3-4H2,1-2H3;1-2H3/b18-13+,20-9-,21-10+,22-12-,25-14+;; |
| InChIKey | MWWGOXZFSWWBHF-DDAMGLBFSA-N |
| XLogP | 8.09 |
| TPSA | 65.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.73 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|