C19H25N3O — CID 137427714
N-[(2E,4E)-5-[ethenyl(propan-2-yl)amino]hepta-2,4,6-trienyl]-4H-azepine-6-carboxamide (PubChem CID 137427714) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[(2E,4E)-5-[ethenyl(propan-2-yl)amino]hepta-2,4,6-trienyl]-4H-azepine-6-carboxamide.
| Compound Name | N-[(2E,4E)-5-[ethenyl(propan-2-yl)amino]hepta-2,4,6-trienyl]-4H-azepine-6-carboxamide |
|---|---|
| PubChem CID | 137427714 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-[(2E,4E)-5-[ethenyl(propan-2-yl)amino]hepta-2,4,6-trienyl]-4H-azepine-6-carboxamide |
| SMILES | C=C/C(=C\C=C\CNC(=O)C1=CCC=CN=C1)N(C=C)C(C)C |
| InChI | InChI=1S/C19H25N3O/c1-5-18(22(6-2)16(3)4)12-8-10-14-21-19(23)17-11-7-9-13-20-15-17/h5-6,8-13,15-16H,1-2,7,14H2,3-4H3,(H,21,23)/b10-8+,18-12+ |
| InChIKey | BTSDIMOYBIFJIH-KWKAUDIHSA-N |
| XLogP | 3.50 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|