C18H28N2O — CID 123513841
(2E)-2-but-2-en-2-yl-N-[(E)-2-(propylideneamino)pent-1-enyl]hexa-2,4-dienamide (PubChem CID 123513841) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is (2E)-2-but-2-en-2-yl-N-[(E)-2-(propylideneamino)pent-1-enyl]hexa-2,4-dienamide.
| Compound Name | (2E)-2-but-2-en-2-yl-N-[(E)-2-(propylideneamino)pent-1-enyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 123513841 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | (2E)-2-but-2-en-2-yl-N-[(E)-2-(propylideneamino)pent-1-enyl]hexa-2,4-dienamide |
| SMILES | CC=C/C=C(/C(=O)N/C=C(CCC)/N=C/CC)C(C)=CC |
| InChI | InChI=1S/C18H28N2O/c1-6-10-12-17(15(5)9-4)18(21)20-14-16(11-7-2)19-13-8-3/h6,9-10,12-14H,7-8,11H2,1-5H3,(H,20,21)/b10-6?,15-9?,16-14+,17-12+,19-13+ |
| InChIKey | BVOAOQXSJPMVDY-UWYJUZJRSA-N |
| XLogP | 4.69 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|