C19H35N3O2 — CID 142078577
N,2-dimethylbutanamide;propane;N,3,7-trimethyl-3H-azepine-6-carboxamide (PubChem CID 142078577) has the molecular formula C19H35N3O2 and a molecular weight of 337.51 g/mol. Its IUPAC name is N,2-dimethylbutanamide;propane;N,3,7-trimethyl-3H-azepine-6-carboxamide.
| Compound Name | N,2-dimethylbutanamide;propane;N,3,7-trimethyl-3H-azepine-6-carboxamide |
|---|---|
| PubChem CID | 142078577 |
| Molecular Formula | C19H35N3O2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.27 |
| IUPAC Name | N,2-dimethylbutanamide;propane;N,3,7-trimethyl-3H-azepine-6-carboxamide |
| SMILES | CCC.CCC(C)C(=O)NC.CNC(=O)C1=C(C)N=CC(C)C=C1 |
| InChI | InChI=1S/C10H14N2O.C6H13NO.C3H8/c1-7-4-5-9(10(13)11-3)8(2)12-6-7;1-4-5(2)6(8)7-3;1-3-2/h4-7H,1-3H3,(H,11,13);5H,4H2,1-3H3,(H,7,8);3H2,1-2H3 |
| InChIKey | UTDNPVOXDSKZTL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |