C12H20N2O — CID 178151414
(E)-2-ethyl-N,4-dimethyl-3-(prop-2-enylideneamino)pent-2-enamide (PubChem CID 178151414) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is (E)-2-ethyl-N,4-dimethyl-3-(prop-2-enylideneamino)pent-2-enamide.
| Compound Name | (E)-2-ethyl-N,4-dimethyl-3-(prop-2-enylideneamino)pent-2-enamide |
|---|---|
| PubChem CID | 178151414 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (E)-2-ethyl-N,4-dimethyl-3-(prop-2-enylideneamino)pent-2-enamide |
| SMILES | C=C/C=N/C(=C(\CC)C(=O)NC)C(C)C |
| InChI | InChI=1S/C12H20N2O/c1-6-8-14-11(9(3)4)10(7-2)12(15)13-5/h6,8-9H,1,7H2,2-5H3,(H,13,15)/b11-10+,14-8+ |
| InChIKey | CSVWHBSPBNDKAU-QJYCHBTISA-N |
| XLogP | 2.31 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|