C12H20N2O — CID 164865322
4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one;ethane (PubChem CID 164865322) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one;ethane.
| Compound Name | 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one;ethane |
|---|---|
| PubChem CID | 164865322 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-[[(Z)-but-2-enylidene]amino]-3-ethyl-1,2-dihydropyrrol-5-one;ethane |
| SMILES | C/C=C\C=N\C1=C(CC)CNC1=O.CC |
| InChI | InChI=1S/C10H14N2O.C2H6/c1-3-5-6-11-9-8(4-2)7-12-10(9)13;1-2/h3,5-6H,4,7H2,1-2H3,(H,12,13);1-2H3/b5-3-,11-6+; |
| InChIKey | XDXRKROPWXYLND-GHFGPCLASA-N |
| XLogP | 2.45 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|