C12H22N2O — CID 164865273
ethane;4-methyl-3-(prop-2-enylideneamino)-1,2-dihydropyrrol-5-one (PubChem CID 164865273) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is ethane;4-methyl-3-(prop-2-enylideneamino)-1,2-dihydropyrrol-5-one.
| Compound Name | ethane;4-methyl-3-(prop-2-enylideneamino)-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 164865273 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | ethane;4-methyl-3-(prop-2-enylideneamino)-1,2-dihydropyrrol-5-one |
| SMILES | C=C/C=N/C1=C(C)C(=O)NC1.CC.CC |
| InChI | InChI=1S/C8H10N2O.2C2H6/c1-3-4-9-7-5-10-8(11)6(7)2;2*1-2/h3-4H,1,5H2,2H3,(H,10,11);2*1-2H3/b9-4+;; |
| InChIKey | ZYBARDZICYYMIS-HPJBNNNXSA-N |
| XLogP | 2.70 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|