C11H17NO — CID 145152777
ethane;(3E,4E)-3-ethylidene-4-prop-2-enylidenepyrrolidin-2-one (PubChem CID 145152777) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is ethane;(3E,4E)-3-ethylidene-4-prop-2-enylidenepyrrolidin-2-one.
| Compound Name | ethane;(3E,4E)-3-ethylidene-4-prop-2-enylidenepyrrolidin-2-one |
|---|---|
| PubChem CID | 145152777 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | ethane;(3E,4E)-3-ethylidene-4-prop-2-enylidenepyrrolidin-2-one |
| SMILES | C=C/C=C1/CNC(=O)/C1=C/C.CC |
| InChI | InChI=1S/C9H11NO.C2H6/c1-3-5-7-6-10-9(11)8(7)4-2;1-2/h3-5H,1,6H2,2H3,(H,10,11);1-2H3/b7-5-,8-4+; |
| InChIKey | NMBHXYFGVICKFS-HTQNWGDESA-N |
| XLogP | 2.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|