C12H18O2 — CID 143243807
ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylideneoxan-2-one (PubChem CID 143243807) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylideneoxan-2-one.
| Compound Name | ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylideneoxan-2-one |
|---|---|
| PubChem CID | 143243807 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | ethane;(5Z,6E)-6-ethylidene-5-prop-2-enylideneoxan-2-one |
| SMILES | C=C/C=C1/CCC(=O)O/C1=C/C.CC |
| InChI | InChI=1S/C10H12O2.C2H6/c1-3-5-8-6-7-10(11)12-9(8)4-2;1-2/h3-5H,1,6-7H2,2H3;1-2H3/b8-5-,9-4+; |
| InChIKey | DQTIHBNDBSKEMA-HHHUAFAMSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |