C17H30O3 — CID 144582200
ethane;(4E,5Z)-4-ethylidene-3-oxo-5-prop-2-enylidenecyclohexane-1-carboxylic acid;methane (PubChem CID 144582200) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is ethane;(4E,5Z)-4-ethylidene-3-oxo-5-prop-2-enylidenecyclohexane-1-carboxylic acid;methane.
| Compound Name | ethane;(4E,5Z)-4-ethylidene-3-oxo-5-prop-2-enylidenecyclohexane-1-carboxylic acid;methane |
|---|---|
| PubChem CID | 144582200 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | ethane;(4E,5Z)-4-ethylidene-3-oxo-5-prop-2-enylidenecyclohexane-1-carboxylic acid;methane |
| SMILES | C.C=C/C=C1/CC(C(=O)O)CC(=O)/C1=C/C.CC.CC |
| InChI | InChI=1S/C12H14O3.2C2H6.CH4/c1-3-5-8-6-9(12(14)15)7-11(13)10(8)4-2;2*1-2;/h3-5,9H,1,6-7H2,2H3,(H,14,15);2*1-2H3;1H4/b8-5-,10-4+;;; |
| InChIKey | IALSSGSFCZSXBW-ULIWHEFJSA-N |
| XLogP | 4.80 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|