C11H14O5 — CID 14371511
4-(1-hydroxy-2-methylpropylidene)-3,5-dioxocyclohexane-1-carboxylic acid (PubChem CID 14371511) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 4-(1-hydroxy-2-methylpropylidene)-3,5-dioxocyclohexane-1-carboxylic acid.
| Compound Name | 4-(1-hydroxy-2-methylpropylidene)-3,5-dioxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 14371511 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-(1-hydroxy-2-methylpropylidene)-3,5-dioxocyclohexane-1-carboxylic acid |
| SMILES | CC(C)C(O)=C1C(=O)CC(C(=O)O)CC1=O |
| InChI | InChI=1S/C11H14O5/c1-5(2)10(14)9-7(12)3-6(11(15)16)4-8(9)13/h5-6,14H,3-4H2,1-2H3,(H,15,16)/b10-9- |
| InChIKey | PUWVSQHCGJNGLI-KTKRTIGZSA-N |
| XLogP | 1.09 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|