C11H18NP — CID 142943306
(4Z,5Z)-5-ethylidene-2-phosphanyl-4-prop-2-enylidenecyclohexan-1-amine (PubChem CID 142943306) has the molecular formula C11H18NP and a molecular weight of 195.25 g/mol. Its IUPAC name is (4Z,5Z)-5-ethylidene-2-phosphanyl-4-prop-2-enylidenecyclohexan-1-amine.
| Compound Name | (4Z,5Z)-5-ethylidene-2-phosphanyl-4-prop-2-enylidenecyclohexan-1-amine |
|---|---|
| PubChem CID | 142943306 |
| Molecular Formula | C11H18NP |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | (4Z,5Z)-5-ethylidene-2-phosphanyl-4-prop-2-enylidenecyclohexan-1-amine |
| SMILES | C=C/C=C1/CC(P)C(N)C/C1=C/C |
| InChI | InChI=1S/C11H18NP/c1-3-5-9-7-11(13)10(12)6-8(9)4-2/h3-5,10-11H,1,6-7,12-13H2,2H3/b8-4-,9-5- |
| InChIKey | JAXXTMCOXBQWAC-XEQVNJCQSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|