C10H15N — CID 143992875
(4Z)-N-methyl-3-methylidene-4-prop-2-enylidenecyclopentan-1-amine (PubChem CID 143992875) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (4Z)-N-methyl-3-methylidene-4-prop-2-enylidenecyclopentan-1-amine.
| Compound Name | (4Z)-N-methyl-3-methylidene-4-prop-2-enylidenecyclopentan-1-amine |
|---|---|
| PubChem CID | 143992875 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (4Z)-N-methyl-3-methylidene-4-prop-2-enylidenecyclopentan-1-amine |
| SMILES | C=C/C=C1/CC(NC)CC1=C |
| InChI | InChI=1S/C10H15N/c1-4-5-9-7-10(11-3)6-8(9)2/h4-5,10-11H,1-2,6-7H2,3H3/b9-5- |
| InChIKey | IXMRQYWPNCHNRW-UITAMQMPSA-N |
| XLogP | 2.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |