C15H22NO3S- — CID 129306794
(2E,3Z,5R)-2-ethylidene-5-(3-oxobutan-2-ylamino)-3-prop-2-enylidenecyclohexane-1-sulfinate (PubChem CID 129306794) has the molecular formula C15H22NO3S- and a molecular weight of 296.41 g/mol. Its IUPAC name is (2E,3Z,5R)-2-ethylidene-5-(3-oxobutan-2-ylamino)-3-prop-2-enylidenecyclohexane-1-sulfinate.
| Compound Name | (2E,3Z,5R)-2-ethylidene-5-(3-oxobutan-2-ylamino)-3-prop-2-enylidenecyclohexane-1-sulfinate |
|---|---|
| PubChem CID | 129306794 |
| Molecular Formula | C15H22NO3S- |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2E,3Z,5R)-2-ethylidene-5-(3-oxobutan-2-ylamino)-3-prop-2-enylidenecyclohexane-1-sulfinate |
| SMILES | C=C/C=C1/C[C@@H](NC(C)C(C)=O)CC(S(=O)[O-])/C1=C/C |
| InChI | InChI=1S/C15H23NO3S/c1-5-7-12-8-13(16-10(3)11(4)17)9-15(20(18)19)14(12)6-2/h5-7,10,13,15-16H,1,8-9H2,2-4H3,(H,18,19)/p-1/b12-7-,14-6+/t10?,13-,15?/m1/s1 |
| InChIKey | YVOJJTOQGXMZJB-MLLFDGGESA-M |
| XLogP | 2.02 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|