C16H34NP — CID 142832926
(2E,3Z)-2,3-di(ethylidene)-6-phosphanylcyclohexan-1-amine;ethane;ethene (PubChem CID 142832926) has the molecular formula C16H34NP and a molecular weight of 271.43 g/mol. Its IUPAC name is (2E,3Z)-2,3-di(ethylidene)-6-phosphanylcyclohexan-1-amine;ethane;ethene.
| Compound Name | (2E,3Z)-2,3-di(ethylidene)-6-phosphanylcyclohexan-1-amine;ethane;ethene |
|---|---|
| PubChem CID | 142832926 |
| Molecular Formula | C16H34NP |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.24 |
| IUPAC Name | (2E,3Z)-2,3-di(ethylidene)-6-phosphanylcyclohexan-1-amine;ethane;ethene |
| SMILES | C/C=C1/CCC(P)C(N)/C1=C/C.C=C.CC.CC |
| InChI | InChI=1S/C10H18NP.2C2H6.C2H4/c1-3-7-5-6-9(12)10(11)8(7)4-2;3*1-2/h3-4,9-10H,5-6,11-12H2,1-2H3;2*1-2H3;1-2H2/b7-3-,8-4+;;; |
| InChIKey | UBSDKZPRSATDAF-JTZRWUKUSA-N |
| XLogP | 5.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|