C8H13N — CID 143343692
(2E)-2-ethylidene-3-methylidenecyclopentan-1-amine (PubChem CID 143343692) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is (2E)-2-ethylidene-3-methylidenecyclopentan-1-amine.
| Compound Name | (2E)-2-ethylidene-3-methylidenecyclopentan-1-amine |
|---|---|
| PubChem CID | 143343692 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (2E)-2-ethylidene-3-methylidenecyclopentan-1-amine |
| SMILES | C=C1CCC(N)/C1=C/C |
| InChI | InChI=1S/C8H13N/c1-3-7-6(2)4-5-8(7)9/h3,8H,2,4-5,9H2,1H3/b7-3+ |
| InChIKey | FOLUBIYXFJTPMR-XVNBXDOJSA-N |
| XLogP | 1.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |