C14H23NO2 — CID 134341594
tert-butyl N-[(2E)-2-ethylidene-3-methylidenecyclopentyl]-N-methylcarbamate (PubChem CID 134341594) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is tert-butyl N-[(2E)-2-ethylidene-3-methylidenecyclopentyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2E)-2-ethylidene-3-methylidenecyclopentyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 134341594 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | tert-butyl N-[(2E)-2-ethylidene-3-methylidenecyclopentyl]-N-methylcarbamate |
| SMILES | C=C1CCC(N(C)C(=O)OC(C)(C)C)/C1=C/C |
| InChI | InChI=1S/C14H23NO2/c1-7-11-10(2)8-9-12(11)15(6)13(16)17-14(3,4)5/h7,12H,2,8-9H2,1,3-6H3/b11-7+ |
| InChIKey | KLIAAEWXRJDTIR-YRNVUSSQSA-N |
| XLogP | 3.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |