C15H25NO2S — CID 177018342
tert-butyl N-(3-ethenyl-4-methylsulfanylcyclohex-3-en-1-yl)-N-methylcarbamate (PubChem CID 177018342) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is tert-butyl N-(3-ethenyl-4-methylsulfanylcyclohex-3-en-1-yl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(3-ethenyl-4-methylsulfanylcyclohex-3-en-1-yl)-N-methylcarbamate |
|---|---|
| PubChem CID | 177018342 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | tert-butyl N-(3-ethenyl-4-methylsulfanylcyclohex-3-en-1-yl)-N-methylcarbamate |
| SMILES | C=CC1=C(SC)CCC(N(C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H25NO2S/c1-7-11-10-12(8-9-13(11)19-6)16(5)14(17)18-15(2,3)4/h7,12H,1,8-10H2,2-6H3 |
| InChIKey | UQZDUHLAMUBGFC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |