C10H16NP — CID 143214136
N-[(E)-[(2Z)-2-ethylidene-6-phosphanylcyclohexylidene]methyl]methanimine (PubChem CID 143214136) has the molecular formula C10H16NP and a molecular weight of 181.22 g/mol. Its IUPAC name is N-[(E)-[(2Z)-2-ethylidene-6-phosphanylcyclohexylidene]methyl]methanimine.
| Compound Name | N-[(E)-[(2Z)-2-ethylidene-6-phosphanylcyclohexylidene]methyl]methanimine |
|---|---|
| PubChem CID | 143214136 |
| Molecular Formula | C10H16NP |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | N-[(E)-[(2Z)-2-ethylidene-6-phosphanylcyclohexylidene]methyl]methanimine |
| SMILES | C=N/C=C1C(=C/C)\CCCC\1P |
| InChI | InChI=1S/C10H16NP/c1-3-8-5-4-6-10(12)9(8)7-11-2/h3,7,10H,2,4-6,12H2,1H3/b8-3-,9-7+ |
| InChIKey | SZWKIAZGTIWPFG-HESJCCPHSA-N |
| XLogP | 2.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|