C13H23N — CID 153388202
(2E,6Z)-2,6-di(ethylidene)-N-methylcyclohexan-1-imine;ethane (PubChem CID 153388202) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (2E,6Z)-2,6-di(ethylidene)-N-methylcyclohexan-1-imine;ethane.
| Compound Name | (2E,6Z)-2,6-di(ethylidene)-N-methylcyclohexan-1-imine;ethane |
|---|---|
| PubChem CID | 153388202 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (2E,6Z)-2,6-di(ethylidene)-N-methylcyclohexan-1-imine;ethane |
| SMILES | C/C=C1/CCCC(=C\C)/C1=N\C.CC |
| InChI | InChI=1S/C11H17N.C2H6/c1-4-9-7-6-8-10(5-2)11(9)12-3;1-2/h4-5H,6-8H2,1-3H3;1-2H3/b9-4-,10-5+,12-11-; |
| InChIKey | MJFBQQPDQWCVSD-XPKCIDAASA-N |
| XLogP | 4.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|