About (3Z)-3-ethylidene-N-methylpiperidin-4-imine
(3Z)-3-ethylidene-N-methylpiperidin-4-imine (PubChem CID 143890086) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (3Z)-3-ethylidene-N-methylpiperidin-4-imine.
Molecular Properties
| Compound Name | (3Z)-3-ethylidene-N-methylpiperidin-4-imine |
| PubChem CID | 143890086 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (3Z)-3-ethylidene-N-methylpiperidin-4-imine |
| SMILES | C/C=C1/CNCC/C1=N\C |
| InChI | InChI=1S/C8H14N2/c1-3-7-6-10-5-4-8(7)9-2/h3,10H,4-6H2,1-2H3/b7-3-,9-8+ |
| InChIKey | PVBUVLJPWGVOKS-UHCVJZAXSA-N |
| XLogP | 1.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-ethylidene-N-methylpiperidin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-ethylidene-N-methylpiperidin-4-imine?
The IUPAC name of (3Z)-3-ethylidene-N-methylpiperidin-4-imine (CID 143890086) is (3Z)-3-ethylidene-N-methylpiperidin-4-imine.
What is the SMILES notation for (3Z)-3-ethylidene-N-methylpiperidin-4-imine?
The canonical SMILES for (3Z)-3-ethylidene-N-methylpiperidin-4-imine is C/C=C1/CNCC/C1=N\C.
What is the InChIKey of (3Z)-3-ethylidene-N-methylpiperidin-4-imine?
The InChIKey is PVBUVLJPWGVOKS-UHCVJZAXSA-N. The full InChI is InChI=1S/C8H14N2/c1-3-7-6-10-5-4-8(7)9-2/h3,10H,4-6H2,1-2H3/b7-3-,9-8+.
What are the key properties of (3Z)-3-ethylidene-N-methylpiperidin-4-imine?
(3Z)-3-ethylidene-N-methylpiperidin-4-imine has a molecular weight of 138.21 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-ethylidene-N-methylpiperidin-4-imine is sourced from PubChem (CID 143890086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).